C22H23F2NO4S — CID 143400770
5-[3-[4-[(E)-4,4-difluoro-4-phenylbut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]propyl]thiophene-2-carboxylic acid (PubChem CID 143400770) has the molecular formula C22H23F2NO4S and a molecular weight of 435.49 g/mol. Its IUPAC name is 5-[3-[4-[(E)-4,4-difluoro-4-phenylbut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[4-[(E)-4,4-difluoro-4-phenylbut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 143400770 |
| Molecular Formula | C22H23F2NO4S |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 5-[3-[4-[(E)-4,4-difluoro-4-phenylbut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]propyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CCCN2C(=O)OCCC2/C=C/CC(F)(F)c2ccccc2)s1 |
| InChI | InChI=1S/C22H23F2NO4S/c23-22(24,16-6-2-1-3-7-16)13-4-8-17-12-15-29-21(28)25(17)14-5-9-18-10-11-19(30-18)20(26)27/h1-4,6-8,10-11,17H,5,9,12-15H2,(H,26,27)/b8-4+ |
| InChIKey | WUPKNRAZTJDABC-XBXARRHUSA-N |
| XLogP | 5.33 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|