C25H27F2NO4 — CID 143400806
4-[2-[(4R)-4-[(E)-4-(3,5-dimethylphenyl)-4,4-difluorobut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]ethyl]benzoic acid (PubChem CID 143400806) has the molecular formula C25H27F2NO4 and a molecular weight of 443.49 g/mol. Its IUPAC name is 4-[2-[(4R)-4-[(E)-4-(3,5-dimethylphenyl)-4,4-difluorobut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(4R)-4-[(E)-4-(3,5-dimethylphenyl)-4,4-difluorobut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 143400806 |
| Molecular Formula | C25H27F2NO4 |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 4-[2-[(4R)-4-[(E)-4-(3,5-dimethylphenyl)-4,4-difluorobut-1-enyl]-2-oxo-1,3-oxazinan-3-yl]ethyl]benzoic acid |
| SMILES | Cc1cc(C)cc(C(F)(F)C/C=C/[C@H]2CCOC(=O)N2CCc2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C25H27F2NO4/c1-17-14-18(2)16-21(15-17)25(26,27)11-3-4-22-10-13-32-24(31)28(22)12-9-19-5-7-20(8-6-19)23(29)30/h3-8,14-16,22H,9-13H2,1-2H3,(H,29,30)/b4-3+/t22-/m0/s1 |
| InChIKey | YGHZWPGCKKFYEP-SIAOZKNOSA-N |
| XLogP | 5.49 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|