About formaldehyde;(2S)-N-methyl-2-prop-1-en-2-ylpyrrolidin-1-amine
formaldehyde;(2S)-N-methyl-2-prop-1-en-2-ylpyrrolidin-1-amine (PubChem CID 143401668) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is formaldehyde;(2S)-N-methyl-2-prop-1-en-2-ylpyrrolidin-1-amine.
Molecular Properties
| Compound Name | formaldehyde;(2S)-N-methyl-2-prop-1-en-2-ylpyrrolidin-1-amine |
| PubChem CID | 143401668 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | formaldehyde;(2S)-N-methyl-2-prop-1-en-2-ylpyrrolidin-1-amine |
| SMILES | C=C(C)[C@@H]1CCCN1NC.C=O |
| InChI | InChI=1S/C8H16N2.CH2O/c1-7(2)8-5-4-6-10(8)9-3;1-2/h8-9H,1,4-6H2,2-3H3;1H2/t8-;/m0./s1 |
| InChIKey | DXUBWLPSTUTFRH-QRPNPIFTSA-N |
| XLogP | 0.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;(2S)-N-methyl-2-prop-1-en-2-ylpyrrolidin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;(2S)-N-methyl-2-prop-1-en-2-ylpyrrolidin-1-amine?
The IUPAC name of formaldehyde;(2S)-N-methyl-2-prop-1-en-2-ylpyrrolidin-1-amine (CID 143401668) is formaldehyde;(2S)-N-methyl-2-prop-1-en-2-ylpyrrolidin-1-amine.
What is the SMILES notation for formaldehyde;(2S)-N-methyl-2-prop-1-en-2-ylpyrrolidin-1-amine?
The canonical SMILES for formaldehyde;(2S)-N-methyl-2-prop-1-en-2-ylpyrrolidin-1-amine is C=C(C)[C@@H]1CCCN1NC.C=O.
What is the InChIKey of formaldehyde;(2S)-N-methyl-2-prop-1-en-2-ylpyrrolidin-1-amine?
The InChIKey is DXUBWLPSTUTFRH-QRPNPIFTSA-N. The full InChI is InChI=1S/C8H16N2.CH2O/c1-7(2)8-5-4-6-10(8)9-3;1-2/h8-9H,1,4-6H2,2-3H3;1H2/t8-;/m0./s1.
What are the key properties of formaldehyde;(2S)-N-methyl-2-prop-1-en-2-ylpyrrolidin-1-amine?
formaldehyde;(2S)-N-methyl-2-prop-1-en-2-ylpyrrolidin-1-amine has a molecular weight of 170.26 g/mol, XLogP of 0.98, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;(2S)-N-methyl-2-prop-1-en-2-ylpyrrolidin-1-amine is sourced from PubChem (CID 143401668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).