C15H25NO2 — CID 143402006
4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-4-ethoxypiperidin-3-ol (PubChem CID 143402006) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-4-ethoxypiperidin-3-ol.
| Compound Name | 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-4-ethoxypiperidin-3-ol |
|---|---|
| PubChem CID | 143402006 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-4-ethoxypiperidin-3-ol |
| SMILES | C=C/C(=C\C=C/C)CC1(OCC)CCNCC1O |
| InChI | InChI=1S/C15H25NO2/c1-4-7-8-13(5-2)11-15(18-6-3)9-10-16-12-14(15)17/h4-5,7-8,14,16-17H,2,6,9-12H2,1,3H3/b7-4-,13-8+ |
| InChIKey | ZMXONRQROGKASG-PZADHXCOSA-N |
| XLogP | 2.19 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|