About ethane;4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methoxypiperidin-3-ol
ethane;4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methoxypiperidin-3-ol (PubChem CID 143402022) has the molecular formula C14H27NO2
and a molecular weight of 241.38 g/mol. Its IUPAC name is ethane;4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methoxypiperidin-3-ol.
Molecular Properties
| Compound Name | ethane;4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methoxypiperidin-3-ol |
| PubChem CID | 143402022 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | ethane;4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methoxypiperidin-3-ol |
| SMILES | C/C=C\C=C(/C)C1(OC)CCNCC1O.CC |
| InChI | InChI=1S/C12H21NO2.C2H6/c1-4-5-6-10(2)12(15-3)7-8-13-9-11(12)14;1-2/h4-6,11,13-14H,7-9H2,1-3H3;1-2H3/b5-4-,10-6+; |
| InChIKey | LSMAERIZDZUGCJ-CTCRGEBPSA-N |
| XLogP | 2.27 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methoxypiperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methoxypiperidin-3-ol?
The IUPAC name of ethane;4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methoxypiperidin-3-ol (CID 143402022) is ethane;4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methoxypiperidin-3-ol.
What is the SMILES notation for ethane;4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methoxypiperidin-3-ol?
The canonical SMILES for ethane;4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methoxypiperidin-3-ol is C/C=C\C=C(/C)C1(OC)CCNCC1O.CC.
What is the InChIKey of ethane;4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methoxypiperidin-3-ol?
The InChIKey is LSMAERIZDZUGCJ-CTCRGEBPSA-N. The full InChI is InChI=1S/C12H21NO2.C2H6/c1-4-5-6-10(2)12(15-3)7-8-13-9-11(12)14;1-2/h4-6,11,13-14H,7-9H2,1-3H3;1-2H3/b5-4-,10-6+;.
What are the key properties of ethane;4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methoxypiperidin-3-ol?
ethane;4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methoxypiperidin-3-ol has a molecular weight of 241.38 g/mol, XLogP of 2.27, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-[(2E,4Z)-hexa-2,4-dien-2-yl]-4-methoxypiperidin-3-ol is sourced from PubChem (CID 143402022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).