About 4-ethoxy-4-[(2E,4Z)-hexa-2,4-dien-2-yl]piperidin-3-ol
4-ethoxy-4-[(2E,4Z)-hexa-2,4-dien-2-yl]piperidin-3-ol (PubChem CID 143402027) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is 4-ethoxy-4-[(2E,4Z)-hexa-2,4-dien-2-yl]piperidin-3-ol.
Molecular Properties
| Compound Name | 4-ethoxy-4-[(2E,4Z)-hexa-2,4-dien-2-yl]piperidin-3-ol |
| PubChem CID | 143402027 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 4-ethoxy-4-[(2E,4Z)-hexa-2,4-dien-2-yl]piperidin-3-ol |
| SMILES | C/C=C\C=C(/C)C1(OCC)CCNCC1O |
| InChI | InChI=1S/C13H23NO2/c1-4-6-7-11(3)13(16-5-2)8-9-14-10-12(13)15/h4,6-7,12,14-15H,5,8-10H2,1-3H3/b6-4-,11-7+ |
| InChIKey | QHZMCPCUTPQQCK-WXVRQDIQSA-N |
| XLogP | 1.64 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-4-[(2E,4Z)-hexa-2,4-dien-2-yl]piperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-4-[(2E,4Z)-hexa-2,4-dien-2-yl]piperidin-3-ol?
The IUPAC name of 4-ethoxy-4-[(2E,4Z)-hexa-2,4-dien-2-yl]piperidin-3-ol (CID 143402027) is 4-ethoxy-4-[(2E,4Z)-hexa-2,4-dien-2-yl]piperidin-3-ol.
What is the SMILES notation for 4-ethoxy-4-[(2E,4Z)-hexa-2,4-dien-2-yl]piperidin-3-ol?
The canonical SMILES for 4-ethoxy-4-[(2E,4Z)-hexa-2,4-dien-2-yl]piperidin-3-ol is C/C=C\C=C(/C)C1(OCC)CCNCC1O.
What is the InChIKey of 4-ethoxy-4-[(2E,4Z)-hexa-2,4-dien-2-yl]piperidin-3-ol?
The InChIKey is QHZMCPCUTPQQCK-WXVRQDIQSA-N. The full InChI is InChI=1S/C13H23NO2/c1-4-6-7-11(3)13(16-5-2)8-9-14-10-12(13)15/h4,6-7,12,14-15H,5,8-10H2,1-3H3/b6-4-,11-7+.
What are the key properties of 4-ethoxy-4-[(2E,4Z)-hexa-2,4-dien-2-yl]piperidin-3-ol?
4-ethoxy-4-[(2E,4Z)-hexa-2,4-dien-2-yl]piperidin-3-ol has a molecular weight of 225.33 g/mol, XLogP of 1.64, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-4-[(2E,4Z)-hexa-2,4-dien-2-yl]piperidin-3-ol is sourced from PubChem (CID 143402027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).