C20H24FNO3 — CID 143402043
(4R)-4-(4-fluorophenyl)azepane;5-methoxy-1,3-benzodioxole (PubChem CID 143402043) has the molecular formula C20H24FNO3 and a molecular weight of 345.41 g/mol. Its IUPAC name is (4R)-4-(4-fluorophenyl)azepane;5-methoxy-1,3-benzodioxole.
| Compound Name | (4R)-4-(4-fluorophenyl)azepane;5-methoxy-1,3-benzodioxole |
|---|---|
| PubChem CID | 143402043 |
| Molecular Formula | C20H24FNO3 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (4R)-4-(4-fluorophenyl)azepane;5-methoxy-1,3-benzodioxole |
| SMILES | COc1ccc2c(c1)OCO2.Fc1ccc([C@@H]2CCCNCC2)cc1 |
| InChI | InChI=1S/C12H16FN.C8H8O3/c13-12-5-3-11(4-6-12)10-2-1-8-14-9-7-10;1-9-6-2-3-7-8(4-6)11-5-10-7/h3-6,10,14H,1-2,7-9H2;2-4H,5H2,1H3/t10-;/m1./s1 |
| InChIKey | YQENPTYUDCATFK-HNCPQSOCSA-N |
| XLogP | 4.11 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |