C26H26N2 — CID 143402088
ethene;2-methyl-N,1-diphenyl-3-[(Z)-prop-1-enyl]indol-5-amine (PubChem CID 143402088) has the molecular formula C26H26N2 and a molecular weight of 366.51 g/mol. Its IUPAC name is ethene;2-methyl-N,1-diphenyl-3-[(Z)-prop-1-enyl]indol-5-amine.
| Compound Name | ethene;2-methyl-N,1-diphenyl-3-[(Z)-prop-1-enyl]indol-5-amine |
|---|---|
| PubChem CID | 143402088 |
| Molecular Formula | C26H26N2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | ethene;2-methyl-N,1-diphenyl-3-[(Z)-prop-1-enyl]indol-5-amine |
| SMILES | C/C=C\c1c(C)n(-c2ccccc2)c2ccc(Nc3ccccc3)cc12.C=C |
| InChI | InChI=1S/C24H22N2.C2H4/c1-3-10-22-18(2)26(21-13-8-5-9-14-21)24-16-15-20(17-23(22)24)25-19-11-6-4-7-12-19;1-2/h3-17,25H,1-2H3;1-2H2/b10-3-; |
| InChIKey | BIBNIWYKZCVYHC-HVHUWTQGSA-N |
| XLogP | 7.52 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|