C15H19F3N2O — CID 143402126
2-[(2S,3S)-2-methyl-1-(2,3,6-trifluoro-4-methanimidoylphenyl)pyrrolidin-3-yl]propan-2-ol (PubChem CID 143402126) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-[(2S,3S)-2-methyl-1-(2,3,6-trifluoro-4-methanimidoylphenyl)pyrrolidin-3-yl]propan-2-ol.
| Compound Name | 2-[(2S,3S)-2-methyl-1-(2,3,6-trifluoro-4-methanimidoylphenyl)pyrrolidin-3-yl]propan-2-ol |
|---|---|
| PubChem CID | 143402126 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-[(2S,3S)-2-methyl-1-(2,3,6-trifluoro-4-methanimidoylphenyl)pyrrolidin-3-yl]propan-2-ol |
| SMILES | [H]/N=C/c1cc(F)c(N2CC[C@H](C(C)(C)O)[C@@H]2C)c(F)c1F |
| InChI | InChI=1S/C15H19F3N2O/c1-8-10(15(2,3)21)4-5-20(8)14-11(16)6-9(7-19)12(17)13(14)18/h6-8,10,19,21H,4-5H2,1-3H3/b19-7+/t8-,10-/m0/s1 |
| InChIKey | YGGAHXOCAOHGLJ-VLESHLMMSA-N |
| XLogP | 3.09 |
| TPSA | 47.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|