About 4-ethenyl-N-ethynyl-5-methyl-1H-pyrazol-3-amine;methane
4-ethenyl-N-ethynyl-5-methyl-1H-pyrazol-3-amine;methane (PubChem CID 143402563) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 4-ethenyl-N-ethynyl-5-methyl-1H-pyrazol-3-amine;methane.
Molecular Properties
| Compound Name | 4-ethenyl-N-ethynyl-5-methyl-1H-pyrazol-3-amine;methane |
| PubChem CID | 143402563 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 4-ethenyl-N-ethynyl-5-methyl-1H-pyrazol-3-amine;methane |
| SMILES | C.C#CNc1n[nH]c(C)c1C=C |
| InChI | InChI=1S/C8H9N3.CH4/c1-4-7-6(3)10-11-8(7)9-5-2;/h2,4H,1H2,3H3,(H2,9,10,11);1H4 |
| InChIKey | KRWQTXOSQDZTKN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-N-ethynyl-5-methyl-1H-pyrazol-3-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-N-ethynyl-5-methyl-1H-pyrazol-3-amine;methane?
The IUPAC name of 4-ethenyl-N-ethynyl-5-methyl-1H-pyrazol-3-amine;methane (CID 143402563) is 4-ethenyl-N-ethynyl-5-methyl-1H-pyrazol-3-amine;methane.
What is the SMILES notation for 4-ethenyl-N-ethynyl-5-methyl-1H-pyrazol-3-amine;methane?
The canonical SMILES for 4-ethenyl-N-ethynyl-5-methyl-1H-pyrazol-3-amine;methane is C.C#CNc1n[nH]c(C)c1C=C.
What is the InChIKey of 4-ethenyl-N-ethynyl-5-methyl-1H-pyrazol-3-amine;methane?
The InChIKey is KRWQTXOSQDZTKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3.CH4/c1-4-7-6(3)10-11-8(7)9-5-2;/h2,4H,1H2,3H3,(H2,9,10,11);1H4.
What are the key properties of 4-ethenyl-N-ethynyl-5-methyl-1H-pyrazol-3-amine;methane?
4-ethenyl-N-ethynyl-5-methyl-1H-pyrazol-3-amine;methane has a molecular weight of 163.22 g/mol, XLogP of 2.00, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-N-ethynyl-5-methyl-1H-pyrazol-3-amine;methane is sourced from PubChem (CID 143402563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).