C17H24F2N2O2 — CID 143402742
(6S,7Z)-11,11-difluoro-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-2,15-dione (PubChem CID 143402742) has the molecular formula C17H24F2N2O2 and a molecular weight of 326.39 g/mol. Its IUPAC name is (6S,7Z)-11,11-difluoro-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-2,15-dione.
| Compound Name | (6S,7Z)-11,11-difluoro-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-2,15-dione |
|---|---|
| PubChem CID | 143402742 |
| Molecular Formula | C17H24F2N2O2 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | (6S,7Z)-11,11-difluoro-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-2,15-dione |
| SMILES | O=C1NC2C[C@H]2/C=C\CCC(F)(F)CCCC(=O)N2CCCC12 |
| InChI | InChI=1S/C17H24F2N2O2/c18-17(19)8-2-1-5-12-11-13(12)20-16(23)14-6-4-10-21(14)15(22)7-3-9-17/h1,5,12-14H,2-4,6-11H2,(H,20,23)/b5-1-/t12-,13?,14?/m1/s1 |
| InChIKey | YOMQUXWLNVCNFK-HHORBQEOSA-N |
| XLogP | 2.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|