About 4-[(Z,2Z)-2-ethylidene-5-fluorohex-3-enyl]-1-methylpiperidine
4-[(Z,2Z)-2-ethylidene-5-fluorohex-3-enyl]-1-methylpiperidine (PubChem CID 143402894) has the molecular formula C14H24FN
and a molecular weight of 225.35 g/mol. Its IUPAC name is 4-[(Z,2Z)-2-ethylidene-5-fluorohex-3-enyl]-1-methylpiperidine.
Molecular Properties
| Compound Name | 4-[(Z,2Z)-2-ethylidene-5-fluorohex-3-enyl]-1-methylpiperidine |
| PubChem CID | 143402894 |
| Molecular Formula | C14H24FN |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | 4-[(Z,2Z)-2-ethylidene-5-fluorohex-3-enyl]-1-methylpiperidine |
| SMILES | C/C=C(\C=C/C(C)F)CC1CCN(C)CC1 |
| InChI | InChI=1S/C14H24FN/c1-4-13(6-5-12(2)15)11-14-7-9-16(3)10-8-14/h4-6,12,14H,7-11H2,1-3H3/b6-5-,13-4+ |
| InChIKey | QJAPPSYDBSLEAL-BDNXDWBHSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z,2Z)-2-ethylidene-5-fluorohex-3-enyl]-1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z,2Z)-2-ethylidene-5-fluorohex-3-enyl]-1-methylpiperidine?
The IUPAC name of 4-[(Z,2Z)-2-ethylidene-5-fluorohex-3-enyl]-1-methylpiperidine (CID 143402894) is 4-[(Z,2Z)-2-ethylidene-5-fluorohex-3-enyl]-1-methylpiperidine.
What is the SMILES notation for 4-[(Z,2Z)-2-ethylidene-5-fluorohex-3-enyl]-1-methylpiperidine?
The canonical SMILES for 4-[(Z,2Z)-2-ethylidene-5-fluorohex-3-enyl]-1-methylpiperidine is C/C=C(\C=C/C(C)F)CC1CCN(C)CC1.
What is the InChIKey of 4-[(Z,2Z)-2-ethylidene-5-fluorohex-3-enyl]-1-methylpiperidine?
The InChIKey is QJAPPSYDBSLEAL-BDNXDWBHSA-N. The full InChI is InChI=1S/C14H24FN/c1-4-13(6-5-12(2)15)11-14-7-9-16(3)10-8-14/h4-6,12,14H,7-11H2,1-3H3/b6-5-,13-4+.
What are the key properties of 4-[(Z,2Z)-2-ethylidene-5-fluorohex-3-enyl]-1-methylpiperidine?
4-[(Z,2Z)-2-ethylidene-5-fluorohex-3-enyl]-1-methylpiperidine has a molecular weight of 225.35 g/mol, XLogP of 3.58, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z,2Z)-2-ethylidene-5-fluorohex-3-enyl]-1-methylpiperidine is sourced from PubChem (CID 143402894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).