C8H12F2S — CID 143402998
(2E,4Z)-1,3-difluoro-6-methylsulfanylhepta-2,4-diene (PubChem CID 143402998) has the molecular formula C8H12F2S and a molecular weight of 178.25 g/mol. Its IUPAC name is (2E,4Z)-1,3-difluoro-6-methylsulfanylhepta-2,4-diene.
| Compound Name | (2E,4Z)-1,3-difluoro-6-methylsulfanylhepta-2,4-diene |
|---|---|
| PubChem CID | 143402998 |
| Molecular Formula | C8H12F2S |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | (2E,4Z)-1,3-difluoro-6-methylsulfanylhepta-2,4-diene |
| SMILES | CSC(C)/C=C\C(F)=C/CF |
| InChI | InChI=1S/C8H12F2S/c1-7(11-2)3-4-8(10)5-6-9/h3-5,7H,6H2,1-2H3/b4-3-,8-5+ |
| InChIKey | FTHMCLBVXZJVEK-HMRFFJRGSA-N |
| XLogP | 3.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|