C18H32Cl2 — CID 143403247
1,2-dichloro-4-(1-methylcyclopropyl)benzene;ethane;propane (PubChem CID 143403247) has the molecular formula C18H32Cl2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 1,2-dichloro-4-(1-methylcyclopropyl)benzene;ethane;propane.
| Compound Name | 1,2-dichloro-4-(1-methylcyclopropyl)benzene;ethane;propane |
|---|---|
| PubChem CID | 143403247 |
| Molecular Formula | C18H32Cl2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1,2-dichloro-4-(1-methylcyclopropyl)benzene;ethane;propane |
| SMILES | CC.CC1(c2ccc(Cl)c(Cl)c2)CC1.CCC.CCC |
| InChI | InChI=1S/C10H10Cl2.2C3H8.C2H6/c1-10(4-5-10)7-2-3-8(11)9(12)6-7;2*1-3-2;1-2/h2-3,6H,4-5H2,1H3;2*3H2,1-2H3;1-2H3 |
| InChIKey | JZKBEAOKXBPFBT-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |