C12H19Cl2N — CID 143403301
(Z)-1,2-dichloroprop-1-ene;(1R,2R)-2-methyl-1-prop-1-en-2-yl-3-azabicyclo[3.1.0]hexane (PubChem CID 143403301) has the molecular formula C12H19Cl2N and a molecular weight of 248.20 g/mol. Its IUPAC name is (Z)-1,2-dichloroprop-1-ene;(1R,2R)-2-methyl-1-prop-1-en-2-yl-3-azabicyclo[3.1.0]hexane.
| Compound Name | (Z)-1,2-dichloroprop-1-ene;(1R,2R)-2-methyl-1-prop-1-en-2-yl-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 143403301 |
| Molecular Formula | C12H19Cl2N |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | (Z)-1,2-dichloroprop-1-ene;(1R,2R)-2-methyl-1-prop-1-en-2-yl-3-azabicyclo[3.1.0]hexane |
| SMILES | C/C(Cl)=C/Cl.C=C(C)[C@@]12CC1CN[C@@H]2C |
| InChI | InChI=1S/C9H15N.C3H4Cl2/c1-6(2)9-4-8(9)5-10-7(9)3;1-3(5)2-4/h7-8,10H,1,4-5H2,2-3H3;2H,1H3/b;3-2-/t7-,8?,9-;/m1./s1 |
| InChIKey | ASJYSRNUNLMEAT-APIXRQMESA-N |
| XLogP | 3.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|