C14H19Cl2N — CID 143403306
1,2-dichlorobenzene;3-propyl-3-azabicyclo[3.1.0]hexane (PubChem CID 143403306) has the molecular formula C14H19Cl2N and a molecular weight of 272.22 g/mol. Its IUPAC name is 1,2-dichlorobenzene;3-propyl-3-azabicyclo[3.1.0]hexane.
| Compound Name | 1,2-dichlorobenzene;3-propyl-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 143403306 |
| Molecular Formula | C14H19Cl2N |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 1,2-dichlorobenzene;3-propyl-3-azabicyclo[3.1.0]hexane |
| SMILES | CCCN1CC2CC2C1.Clc1ccccc1Cl |
| InChI | InChI=1S/C8H15N.C6H4Cl2/c1-2-3-9-5-7-4-8(7)6-9;7-5-3-1-2-4-6(5)8/h7-8H,2-6H2,1H3;1-4H |
| InChIKey | DCBCLOYHBWEFQG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |