C13H16N2 — CID 14340342
N-methyl-1-naphthalen-1-ylethane-1,2-diamine (PubChem CID 14340342) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is N-methyl-1-naphthalen-1-ylethane-1,2-diamine.
| Compound Name | N-methyl-1-naphthalen-1-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 14340342 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | N-methyl-1-naphthalen-1-ylethane-1,2-diamine |
| SMILES | CNC(CN)c1cccc2ccccc12 |
| InChI | InChI=1S/C13H16N2/c1-15-13(9-14)12-8-4-6-10-5-2-3-7-11(10)12/h2-8,13,15H,9,14H2,1H3 |
| InChIKey | SXRQVSGOLPBZOE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |