C17H27F12NO2S — CID 143403466
N,N-dimethylbutan-1-amine;1,1,1,2,2,6,7,7,7-nonafluoro-4-(2-methylsulfonylethyl)-6-(trifluoromethyl)heptane (PubChem CID 143403466) has the molecular formula C17H27F12NO2S and a molecular weight of 537.45 g/mol. Its IUPAC name is N,N-dimethylbutan-1-amine;1,1,1,2,2,6,7,7,7-nonafluoro-4-(2-methylsulfonylethyl)-6-(trifluoromethyl)heptane.
| Compound Name | N,N-dimethylbutan-1-amine;1,1,1,2,2,6,7,7,7-nonafluoro-4-(2-methylsulfonylethyl)-6-(trifluoromethyl)heptane |
|---|---|
| PubChem CID | 143403466 |
| Molecular Formula | C17H27F12NO2S |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | N,N-dimethylbutan-1-amine;1,1,1,2,2,6,7,7,7-nonafluoro-4-(2-methylsulfonylethyl)-6-(trifluoromethyl)heptane |
| SMILES | CCCCN(C)C.CS(=O)(=O)CCC(CC(F)(F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H12F12O2S.C6H15N/c1-26(24,25)3-2-6(5-8(13,14)11(21,22)23)4-7(12,9(15,16)17)10(18,19)20;1-4-5-6-7(2)3/h6H,2-5H2,1H3;4-6H2,1-3H3 |
| InChIKey | VYSJOOGRVGMFIQ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|