C17H24F14N2O2S — CID 143403500
5,6,6,6-tetrafluoro-N-methyl-N-[[methyl(propyl)amino]methyl]-3-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-5-(trifluoromethyl)hexane-1-sulfonamide (PubChem CID 143403500) has the molecular formula C17H24F14N2O2S and a molecular weight of 586.43 g/mol. Its IUPAC name is 5,6,6,6-tetrafluoro-N-methyl-N-[[methyl(propyl)amino]methyl]-3-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-5-(trifluoromethyl)hexane-1-sulfonamide.
| Compound Name | 5,6,6,6-tetrafluoro-N-methyl-N-[[methyl(propyl)amino]methyl]-3-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-5-(trifluoromethyl)hexane-1-sulfonamide |
|---|---|
| PubChem CID | 143403500 |
| Molecular Formula | C17H24F14N2O2S |
| Molecular Weight | 586.43 g/mol |
| Exact Mass | 586.13 |
| IUPAC Name | 5,6,6,6-tetrafluoro-N-methyl-N-[[methyl(propyl)amino]methyl]-3-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-5-(trifluoromethyl)hexane-1-sulfonamide |
| SMILES | CCCN(C)CN(C)S(=O)(=O)CCC(CC(F)(C(F)(F)F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H24F14N2O2S/c1-4-6-32(2)10-33(3)36(34,35)7-5-11(8-12(18,14(20,21)22)15(23,24)25)9-13(19,16(26,27)28)17(29,30)31/h11H,4-10H2,1-3H3 |
| InChIKey | VNCLDFUEOCTPBR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.43 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|