C27H44N4O7 — CID 143403643
tert-butyl 3-[3-[[(2S)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]pyrrolidine-2-carbonyl]amino]-3-oxopropyl]pyrrolidine-1-carboxylate (PubChem CID 143403643) has the molecular formula C27H44N4O7 and a molecular weight of 536.67 g/mol. Its IUPAC name is tert-butyl 3-[3-[[(2S)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]pyrrolidine-2-carbonyl]amino]-3-oxopropyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-[[(2S)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]pyrrolidine-2-carbonyl]amino]-3-oxopropyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143403643 |
| Molecular Formula | C27H44N4O7 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | tert-butyl 3-[3-[[(2S)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]pyrrolidine-2-carbonyl]amino]-3-oxopropyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCC(=O)NC(=O)[C@@H]2CCCN2C(=O)[C@H](CC2CCCC2)CN(O)C=O)C1 |
| InChI | InChI=1S/C27H44N4O7/c1-27(2,3)38-26(36)29-14-12-20(16-29)10-11-23(33)28-24(34)22-9-6-13-31(22)25(35)21(17-30(37)18-32)15-19-7-4-5-8-19/h18-22,37H,4-17H2,1-3H3,(H,28,33,34)/t20?,21-,22+/m1/s1 |
| InChIKey | WIZRKMSYTVWSNG-PDQYLBCOSA-N |
| XLogP | 2.70 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|