C21H40N4O3 — CID 143403998
tert-butyl N-[1-[2-oxo-2-(4-pentan-2-ylpiperazin-1-yl)ethyl]piperidin-4-yl]carbamate (PubChem CID 143403998) has the molecular formula C21H40N4O3 and a molecular weight of 396.58 g/mol. Its IUPAC name is tert-butyl N-[1-[2-oxo-2-(4-pentan-2-ylpiperazin-1-yl)ethyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-oxo-2-(4-pentan-2-ylpiperazin-1-yl)ethyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 143403998 |
| Molecular Formula | C21H40N4O3 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | tert-butyl N-[1-[2-oxo-2-(4-pentan-2-ylpiperazin-1-yl)ethyl]piperidin-4-yl]carbamate |
| SMILES | CCCC(C)N1CCN(C(=O)CN2CCC(NC(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C21H40N4O3/c1-6-7-17(2)24-12-14-25(15-13-24)19(26)16-23-10-8-18(9-11-23)22-20(27)28-21(3,4)5/h17-18H,6-16H2,1-5H3,(H,22,27) |
| InChIKey | UVWZMOPDYOVZEM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |