C25H38N6O2 — CID 143404324
6-[4-[2-[4-[(1S)-cyclobut-2-en-1-yl]piperazin-1-yl]-2-oxoethyl]piperazin-1-yl]-N-pentan-2-ylpyridine-3-carboxamide (PubChem CID 143404324) has the molecular formula C25H38N6O2 and a molecular weight of 454.62 g/mol. Its IUPAC name is 6-[4-[2-[4-[(1S)-cyclobut-2-en-1-yl]piperazin-1-yl]-2-oxoethyl]piperazin-1-yl]-N-pentan-2-ylpyridine-3-carboxamide.
| Compound Name | 6-[4-[2-[4-[(1S)-cyclobut-2-en-1-yl]piperazin-1-yl]-2-oxoethyl]piperazin-1-yl]-N-pentan-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 143404324 |
| Molecular Formula | C25H38N6O2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | 6-[4-[2-[4-[(1S)-cyclobut-2-en-1-yl]piperazin-1-yl]-2-oxoethyl]piperazin-1-yl]-N-pentan-2-ylpyridine-3-carboxamide |
| SMILES | CCCC(C)NC(=O)c1ccc(N2CCN(CC(=O)N3CCN([C@@H]4C=CC4)CC3)CC2)nc1 |
| InChI | InChI=1S/C25H38N6O2/c1-3-5-20(2)27-25(33)21-8-9-23(26-18-21)30-12-10-28(11-13-30)19-24(32)31-16-14-29(15-17-31)22-6-4-7-22/h4,6,8-9,18,20,22H,3,5,7,10-17,19H2,1-2H3,(H,27,33)/t20?,22-/m1/s1 |
| InChIKey | SZVOOYCSFIWRFV-LWMIZPGFSA-N |
| XLogP | 1.59 |
| TPSA | 72.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|