About N'-cyclobutyl-N-ethyl-N,N'-dimethylethane-1,2-diamine
N'-cyclobutyl-N-ethyl-N,N'-dimethylethane-1,2-diamine (PubChem CID 143404354) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is N'-cyclobutyl-N-ethyl-N,N'-dimethylethane-1,2-diamine.
Analyze N'-cyclobutyl-N-ethyl-N,N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclobutyl-N-ethyl-N,N'-dimethylethane-1,2-diamine?
The IUPAC name of N'-cyclobutyl-N-ethyl-N,N'-dimethylethane-1,2-diamine (CID 143404354) is N'-cyclobutyl-N-ethyl-N,N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N'-cyclobutyl-N-ethyl-N,N'-dimethylethane-1,2-diamine?
The canonical SMILES for N'-cyclobutyl-N-ethyl-N,N'-dimethylethane-1,2-diamine is CCN(C)CCN(C)C1CCC1.
What is the InChIKey of N'-cyclobutyl-N-ethyl-N,N'-dimethylethane-1,2-diamine?
The InChIKey is FZWLRYGVFYCLPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2/c1-4-11(2)8-9-12(3)10-6-5-7-10/h10H,4-9H2,1-3H3.
What are the key properties of N'-cyclobutyl-N-ethyl-N,N'-dimethylethane-1,2-diamine?
N'-cyclobutyl-N-ethyl-N,N'-dimethylethane-1,2-diamine has a molecular weight of 170.30 g/mol, XLogP of 1.42, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclobutyl-N-ethyl-N,N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 143404354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).