C22H32N2O — CID 143404370
ethane;2-[(2E,5Z)-2-methylhepta-2,5-dienyl]spiro[isoindole-3,4'-piperidine]-1-one (PubChem CID 143404370) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is ethane;2-[(2E,5Z)-2-methylhepta-2,5-dienyl]spiro[isoindole-3,4'-piperidine]-1-one.
| Compound Name | ethane;2-[(2E,5Z)-2-methylhepta-2,5-dienyl]spiro[isoindole-3,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 143404370 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | ethane;2-[(2E,5Z)-2-methylhepta-2,5-dienyl]spiro[isoindole-3,4'-piperidine]-1-one |
| SMILES | C/C=C\C/C=C(\C)CN1C(=O)c2ccccc2C12CCNCC2.CC |
| InChI | InChI=1S/C20H26N2O.C2H6/c1-3-4-5-8-16(2)15-22-19(23)17-9-6-7-10-18(17)20(22)11-13-21-14-12-20;1-2/h3-4,6-10,21H,5,11-15H2,1-2H3;1-2H3/b4-3-,16-8+; |
| InChIKey | BFRWMMCJTZQKSE-LYJSSZDQSA-N |
| XLogP | 4.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|