C16H19NO — CID 143404534
1-[4-[(3Z,5E)-5-aminoocta-3,5,7-trien-2-yl]phenyl]ethanone (PubChem CID 143404534) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 1-[4-[(3Z,5E)-5-aminoocta-3,5,7-trien-2-yl]phenyl]ethanone.
| Compound Name | 1-[4-[(3Z,5E)-5-aminoocta-3,5,7-trien-2-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 143404534 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 1-[4-[(3Z,5E)-5-aminoocta-3,5,7-trien-2-yl]phenyl]ethanone |
| SMILES | C=C/C=C(N)\C=C/C(C)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C16H19NO/c1-4-5-16(17)11-6-12(2)14-7-9-15(10-8-14)13(3)18/h4-12H,1,17H2,2-3H3/b11-6-,16-5+ |
| InChIKey | UTOHBMKDFUOJPK-PXJWROFUSA-N |
| XLogP | 3.58 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|