About 2,3-dichloro-5-methyl-1H-pyrrole;ethane
2,3-dichloro-5-methyl-1H-pyrrole;ethane (PubChem CID 143404608) has the molecular formula C7H11Cl2N
and a molecular weight of 180.08 g/mol. Its IUPAC name is 2,3-dichloro-5-methyl-1H-pyrrole;ethane.
Molecular Properties
| Compound Name | 2,3-dichloro-5-methyl-1H-pyrrole;ethane |
| PubChem CID | 143404608 |
| Molecular Formula | C7H11Cl2N |
| Molecular Weight | 180.08 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 2,3-dichloro-5-methyl-1H-pyrrole;ethane |
| SMILES | CC.Cc1cc(Cl)c(Cl)[nH]1 |
| InChI | InChI=1S/C5H5Cl2N.C2H6/c1-3-2-4(6)5(7)8-3;1-2/h2,8H,1H3;1-2H3 |
| InChIKey | ZBIOJJGPRIKCAY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.08 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-dichloro-5-methyl-1H-pyrrole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloro-5-methyl-1H-pyrrole;ethane?
The IUPAC name of 2,3-dichloro-5-methyl-1H-pyrrole;ethane (CID 143404608) is 2,3-dichloro-5-methyl-1H-pyrrole;ethane.
What is the SMILES notation for 2,3-dichloro-5-methyl-1H-pyrrole;ethane?
The canonical SMILES for 2,3-dichloro-5-methyl-1H-pyrrole;ethane is CC.Cc1cc(Cl)c(Cl)[nH]1.
What is the InChIKey of 2,3-dichloro-5-methyl-1H-pyrrole;ethane?
The InChIKey is ZBIOJJGPRIKCAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5Cl2N.C2H6/c1-3-2-4(6)5(7)8-3;1-2/h2,8H,1H3;1-2H3.
What are the key properties of 2,3-dichloro-5-methyl-1H-pyrrole;ethane?
2,3-dichloro-5-methyl-1H-pyrrole;ethane has a molecular weight of 180.08 g/mol, XLogP of 3.66, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloro-5-methyl-1H-pyrrole;ethane is sourced from PubChem (CID 143404608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).