C23H24F3N3O2S — CID 143404720
1,1,1-trifluoro-2-[1-[[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-(hydroxymethyl)-1-benzothiophen-6-yl]methyl]triazol-4-yl]butan-2-ol (PubChem CID 143404720) has the molecular formula C23H24F3N3O2S and a molecular weight of 463.53 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[1-[[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-(hydroxymethyl)-1-benzothiophen-6-yl]methyl]triazol-4-yl]butan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[1-[[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-(hydroxymethyl)-1-benzothiophen-6-yl]methyl]triazol-4-yl]butan-2-ol |
|---|---|
| PubChem CID | 143404720 |
| Molecular Formula | C23H24F3N3O2S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 1,1,1-trifluoro-2-[1-[[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-(hydroxymethyl)-1-benzothiophen-6-yl]methyl]triazol-4-yl]butan-2-ol |
| SMILES | C=C/C=C\C(=C/C)c1c(CO)sc2cc(Cn3cc(C(O)(CC)C(F)(F)F)nn3)ccc12 |
| InChI | InChI=1S/C23H24F3N3O2S/c1-4-7-8-16(5-2)21-17-10-9-15(11-18(17)32-19(21)14-30)12-29-13-20(27-28-29)22(31,6-3)23(24,25)26/h4-5,7-11,13,30-31H,1,6,12,14H2,2-3H3/b8-7-,16-5+ |
| InChIKey | AQUTZCHSLBNGCQ-OPMQWOTMSA-N |
| XLogP | 5.34 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|