C22H22F4N4O2S — CID 143404724
6-[[amino-[(Z)-2-amino-3-hydroxy-3-(trifluoromethyl)pent-1-enyl]amino]methyl]-3-(3-fluorophenyl)-1-benzothiophene-2-carboxamide (PubChem CID 143404724) has the molecular formula C22H22F4N4O2S and a molecular weight of 482.50 g/mol. Its IUPAC name is 6-[[amino-[(Z)-2-amino-3-hydroxy-3-(trifluoromethyl)pent-1-enyl]amino]methyl]-3-(3-fluorophenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 6-[[amino-[(Z)-2-amino-3-hydroxy-3-(trifluoromethyl)pent-1-enyl]amino]methyl]-3-(3-fluorophenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 143404724 |
| Molecular Formula | C22H22F4N4O2S |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 6-[[amino-[(Z)-2-amino-3-hydroxy-3-(trifluoromethyl)pent-1-enyl]amino]methyl]-3-(3-fluorophenyl)-1-benzothiophene-2-carboxamide |
| SMILES | CCC(O)(/C(N)=C/N(N)Cc1ccc2c(-c3cccc(F)c3)c(C(N)=O)sc2c1)C(F)(F)F |
| InChI | InChI=1S/C22H22F4N4O2S/c1-2-21(32,22(24,25)26)17(27)11-30(29)10-12-6-7-15-16(8-12)33-19(20(28)31)18(15)13-4-3-5-14(23)9-13/h3-9,11,32H,2,10,27,29H2,1H3,(H2,28,31)/b17-11- |
| InChIKey | BNQHQIDOBSRXLL-BOPFTXTBSA-N |
| XLogP | 3.99 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|