C24H26F3N3O2S — CID 143404726
1,1,1-trifluoro-2-[1-[[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-(1-hydroxyethyl)-1-benzothiophen-6-yl]methyl]triazol-4-yl]butan-2-ol (PubChem CID 143404726) has the molecular formula C24H26F3N3O2S and a molecular weight of 477.55 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[1-[[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-(1-hydroxyethyl)-1-benzothiophen-6-yl]methyl]triazol-4-yl]butan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[1-[[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-(1-hydroxyethyl)-1-benzothiophen-6-yl]methyl]triazol-4-yl]butan-2-ol |
|---|---|
| PubChem CID | 143404726 |
| Molecular Formula | C24H26F3N3O2S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 1,1,1-trifluoro-2-[1-[[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-(1-hydroxyethyl)-1-benzothiophen-6-yl]methyl]triazol-4-yl]butan-2-ol |
| SMILES | C=C/C=C\C(=C/C)c1c(C(C)O)sc2cc(Cn3cc(C(O)(CC)C(F)(F)F)nn3)ccc12 |
| InChI | InChI=1S/C24H26F3N3O2S/c1-5-8-9-17(6-2)21-18-11-10-16(12-19(18)33-22(21)15(4)31)13-30-14-20(28-29-30)23(32,7-3)24(25,26)27/h5-6,8-12,14-15,31-32H,1,7,13H2,2-4H3/b9-8-,17-6+ |
| InChIKey | UKWITVMKXUMMFF-JMHSHEGOSA-N |
| XLogP | 5.90 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|