C25H28F3N3O2S — CID 143404732
1,1,1-trifluoro-2-[1-[[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-(2-hydroxypropan-2-yl)-1-benzothiophen-6-yl]methyl]triazol-4-yl]butan-2-ol (PubChem CID 143404732) has the molecular formula C25H28F3N3O2S and a molecular weight of 491.58 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[1-[[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-(2-hydroxypropan-2-yl)-1-benzothiophen-6-yl]methyl]triazol-4-yl]butan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[1-[[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-(2-hydroxypropan-2-yl)-1-benzothiophen-6-yl]methyl]triazol-4-yl]butan-2-ol |
|---|---|
| PubChem CID | 143404732 |
| Molecular Formula | C25H28F3N3O2S |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 1,1,1-trifluoro-2-[1-[[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2-(2-hydroxypropan-2-yl)-1-benzothiophen-6-yl]methyl]triazol-4-yl]butan-2-ol |
| SMILES | C=C/C=C\C(=C/C)c1c(C(C)(C)O)sc2cc(Cn3cc(C(O)(CC)C(F)(F)F)nn3)ccc12 |
| InChI | InChI=1S/C25H28F3N3O2S/c1-6-9-10-17(7-2)21-18-12-11-16(13-19(18)34-22(21)23(4,5)32)14-31-15-20(29-30-31)24(33,8-3)25(26,27)28/h6-7,9-13,15,32-33H,1,8,14H2,2-5H3/b10-9-,17-7+ |
| InChIKey | RRQUALPCFINBQU-MURLZYQFSA-N |
| XLogP | 6.07 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|