C19H20N6O3 — CID 143405150
3,8-dimethyl-1-[4-(5-phenyl-1,2,4-oxadiazol-3-yl)butyl]-7H-purine-2,6-dione (PubChem CID 143405150) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is 3,8-dimethyl-1-[4-(5-phenyl-1,2,4-oxadiazol-3-yl)butyl]-7H-purine-2,6-dione.
| Compound Name | 3,8-dimethyl-1-[4-(5-phenyl-1,2,4-oxadiazol-3-yl)butyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 143405150 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 3,8-dimethyl-1-[4-(5-phenyl-1,2,4-oxadiazol-3-yl)butyl]-7H-purine-2,6-dione |
| SMILES | Cc1nc2c([nH]1)c(=O)n(CCCCc1noc(-c3ccccc3)n1)c(=O)n2C |
| InChI | InChI=1S/C19H20N6O3/c1-12-20-15-16(21-12)24(2)19(27)25(18(15)26)11-7-6-10-14-22-17(28-23-14)13-8-4-3-5-9-13/h3-5,8-9H,6-7,10-11H2,1-2H3,(H,20,21) |
| InChIKey | RKXPKCBJLMHCPH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|