About 2-chloro-N,5-bis(ethenyl)-1H-imidazol-4-amine
2-chloro-N,5-bis(ethenyl)-1H-imidazol-4-amine (PubChem CID 143405177) has the molecular formula C7H8ClN3
and a molecular weight of 169.61 g/mol. Its IUPAC name is 2-chloro-N,5-bis(ethenyl)-1H-imidazol-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N,5-bis(ethenyl)-1H-imidazol-4-amine |
| PubChem CID | 143405177 |
| Molecular Formula | C7H8ClN3 |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | 2-chloro-N,5-bis(ethenyl)-1H-imidazol-4-amine |
| SMILES | C=CNc1nc(Cl)[nH]c1C=C |
| InChI | InChI=1S/C7H8ClN3/c1-3-5-6(9-4-2)11-7(8)10-5/h3-4,9H,1-2H2,(H,10,11) |
| InChIKey | NKCXJMVYFMBWCP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-N,5-bis(ethenyl)-1H-imidazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,5-bis(ethenyl)-1H-imidazol-4-amine?
The IUPAC name of 2-chloro-N,5-bis(ethenyl)-1H-imidazol-4-amine (CID 143405177) is 2-chloro-N,5-bis(ethenyl)-1H-imidazol-4-amine.
What is the SMILES notation for 2-chloro-N,5-bis(ethenyl)-1H-imidazol-4-amine?
The canonical SMILES for 2-chloro-N,5-bis(ethenyl)-1H-imidazol-4-amine is C=CNc1nc(Cl)[nH]c1C=C.
What is the InChIKey of 2-chloro-N,5-bis(ethenyl)-1H-imidazol-4-amine?
The InChIKey is NKCXJMVYFMBWCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN3/c1-3-5-6(9-4-2)11-7(8)10-5/h3-4,9H,1-2H2,(H,10,11).
What are the key properties of 2-chloro-N,5-bis(ethenyl)-1H-imidazol-4-amine?
2-chloro-N,5-bis(ethenyl)-1H-imidazol-4-amine has a molecular weight of 169.61 g/mol, XLogP of 2.26, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,5-bis(ethenyl)-1H-imidazol-4-amine is sourced from PubChem (CID 143405177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).