C32H30N2O3 — CID 143405655
N-[1-hydroxy-2-(1H-indol-3-yl)ethyl]-5-(3-phenylphenyl)-2-propoxybenzamide (PubChem CID 143405655) has the molecular formula C32H30N2O3 and a molecular weight of 490.60 g/mol. Its IUPAC name is N-[1-hydroxy-2-(1H-indol-3-yl)ethyl]-5-(3-phenylphenyl)-2-propoxybenzamide.
| Compound Name | N-[1-hydroxy-2-(1H-indol-3-yl)ethyl]-5-(3-phenylphenyl)-2-propoxybenzamide |
|---|---|
| PubChem CID | 143405655 |
| Molecular Formula | C32H30N2O3 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | N-[1-hydroxy-2-(1H-indol-3-yl)ethyl]-5-(3-phenylphenyl)-2-propoxybenzamide |
| SMILES | CCCOc1ccc(-c2cccc(-c3ccccc3)c2)cc1C(=O)NC(O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C32H30N2O3/c1-2-17-37-30-16-15-25(24-12-8-11-23(18-24)22-9-4-3-5-10-22)19-28(30)32(36)34-31(35)20-26-21-33-29-14-7-6-13-27(26)29/h3-16,18-19,21,31,33,35H,2,17,20H2,1H3,(H,34,36) |
| InChIKey | QTZOIWNZIBIIBU-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|