C30H42N6O3S — CID 143406146
3-N-benzyl-1-N-[2-[[(2S)-1-(cyclopropylmethylamino)-1-oxopropan-2-yl]amino]ethyl]-5-[methyl(piperidin-1-ylsulfanyl)amino]benzene-1,3-dicarboxamide (PubChem CID 143406146) has the molecular formula C30H42N6O3S and a molecular weight of 566.77 g/mol. Its IUPAC name is 3-N-benzyl-1-N-[2-[[(2S)-1-(cyclopropylmethylamino)-1-oxopropan-2-yl]amino]ethyl]-5-[methyl(piperidin-1-ylsulfanyl)amino]benzene-1,3-dicarboxamide.
| Compound Name | 3-N-benzyl-1-N-[2-[[(2S)-1-(cyclopropylmethylamino)-1-oxopropan-2-yl]amino]ethyl]-5-[methyl(piperidin-1-ylsulfanyl)amino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 143406146 |
| Molecular Formula | C30H42N6O3S |
| Molecular Weight | 566.77 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | 3-N-benzyl-1-N-[2-[[(2S)-1-(cyclopropylmethylamino)-1-oxopropan-2-yl]amino]ethyl]-5-[methyl(piperidin-1-ylsulfanyl)amino]benzene-1,3-dicarboxamide |
| SMILES | C[C@H](NCCNC(=O)c1cc(C(=O)NCc2ccccc2)cc(N(C)SN2CCCCC2)c1)C(=O)NCC1CC1 |
| InChI | InChI=1S/C30H42N6O3S/c1-22(28(37)33-21-24-11-12-24)31-13-14-32-29(38)25-17-26(30(39)34-20-23-9-5-3-6-10-23)19-27(18-25)35(2)40-36-15-7-4-8-16-36/h3,5-6,9-10,17-19,22,24,31H,4,7-8,11-16,20-21H2,1-2H3,(H,32,38)(H,33,37)(H,34,39)/t22-/m0/s1 |
| InChIKey | XUWIITKCQJZZBX-QFIPXVFZSA-N |
| XLogP | 3.34 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.77 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|