C37H46N6O5S — CID 143406215
1-N-[2-[[(2S)-1-[(4-aminophenyl)methylamino]-1-oxobutan-2-yl]amino]ethyl]-3-N-benzyl-5-[methyl(methylsulfonyl)amino]benzene-1,3-dicarboxamide;toluene (PubChem CID 143406215) has the molecular formula C37H46N6O5S and a molecular weight of 686.88 g/mol. Its IUPAC name is 1-N-[2-[[(2S)-1-[(4-aminophenyl)methylamino]-1-oxobutan-2-yl]amino]ethyl]-3-N-benzyl-5-[methyl(methylsulfonyl)amino]benzene-1,3-dicarboxamide;toluene.
| Compound Name | 1-N-[2-[[(2S)-1-[(4-aminophenyl)methylamino]-1-oxobutan-2-yl]amino]ethyl]-3-N-benzyl-5-[methyl(methylsulfonyl)amino]benzene-1,3-dicarboxamide;toluene |
|---|---|
| PubChem CID | 143406215 |
| Molecular Formula | C37H46N6O5S |
| Molecular Weight | 686.88 g/mol |
| Exact Mass | 686.33 |
| IUPAC Name | 1-N-[2-[[(2S)-1-[(4-aminophenyl)methylamino]-1-oxobutan-2-yl]amino]ethyl]-3-N-benzyl-5-[methyl(methylsulfonyl)amino]benzene-1,3-dicarboxamide;toluene |
| SMILES | CC[C@H](NCCNC(=O)c1cc(C(=O)NCc2ccccc2)cc(N(C)S(C)(=O)=O)c1)C(=O)NCc1ccc(N)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C30H38N6O5S.C7H8/c1-4-27(30(39)35-20-22-10-12-25(31)13-11-22)32-14-15-33-28(37)23-16-24(18-26(17-23)36(2)42(3,40)41)29(38)34-19-21-8-6-5-7-9-21;1-7-5-3-2-4-6-7/h5-13,16-18,27,32H,4,14-15,19-20,31H2,1-3H3,(H,33,37)(H,34,38)(H,35,39);2-6H,1H3/t27-;/m0./s1 |
| InChIKey | YNZIMPAOBCSFES-YCBFMBTMSA-N |
| XLogP | 4.00 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.88 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|