C21H37NO3 — CID 143406478
9,10-dimethoxy-3-methyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol;methane;2-methylpropane (PubChem CID 143406478) has the molecular formula C21H37NO3 and a molecular weight of 351.53 g/mol. Its IUPAC name is 9,10-dimethoxy-3-methyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol;methane;2-methylpropane.
| Compound Name | 9,10-dimethoxy-3-methyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol;methane;2-methylpropane |
|---|---|
| PubChem CID | 143406478 |
| Molecular Formula | C21H37NO3 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.28 |
| IUPAC Name | 9,10-dimethoxy-3-methyl-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol;methane;2-methylpropane |
| SMILES | C.CC(C)C.COc1cc2c(cc1OC)C1CC(O)C(C)CN1CC2 |
| InChI | InChI=1S/C16H23NO3.C4H10.CH4/c1-10-9-17-5-4-11-6-15(19-2)16(20-3)7-12(11)13(17)8-14(10)18;1-4(2)3;/h6-7,10,13-14,18H,4-5,8-9H2,1-3H3;4H,1-3H3;1H4 |
| InChIKey | XMZGALSKMJLDKV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |