C8H9NO3 — CID 143407126
3-[(2E,4Z)-hexa-2,4-dien-2-yl]-1,3-oxazetidine-2,4-dione (PubChem CID 143407126) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 3-[(2E,4Z)-hexa-2,4-dien-2-yl]-1,3-oxazetidine-2,4-dione.
| Compound Name | 3-[(2E,4Z)-hexa-2,4-dien-2-yl]-1,3-oxazetidine-2,4-dione |
|---|---|
| PubChem CID | 143407126 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 3-[(2E,4Z)-hexa-2,4-dien-2-yl]-1,3-oxazetidine-2,4-dione |
| SMILES | C/C=C\C=C(/C)N1C(=O)OC1=O |
| InChI | InChI=1S/C8H9NO3/c1-3-4-5-6(2)9-7(10)12-8(9)11/h3-5H,1-2H3/b4-3-,6-5+ |
| InChIKey | LRHWGALLYAAIOV-DNVGVPOPSA-N |
| XLogP | 2.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|