C16H27NO2 — CID 143407616
4-[3-[(3E,5Z,7Z)-nona-3,5,7-trien-4-yl]oxypropyl]morpholine (PubChem CID 143407616) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 4-[3-[(3E,5Z,7Z)-nona-3,5,7-trien-4-yl]oxypropyl]morpholine.
| Compound Name | 4-[3-[(3E,5Z,7Z)-nona-3,5,7-trien-4-yl]oxypropyl]morpholine |
|---|---|
| PubChem CID | 143407616 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 4-[3-[(3E,5Z,7Z)-nona-3,5,7-trien-4-yl]oxypropyl]morpholine |
| SMILES | C/C=C\C=C/C(=C\CC)OCCCN1CCOCC1 |
| InChI | InChI=1S/C16H27NO2/c1-3-5-6-9-16(8-4-2)19-13-7-10-17-11-14-18-15-12-17/h3,5-6,8-9H,4,7,10-15H2,1-2H3/b5-3-,9-6-,16-8+ |
| InChIKey | VPZQUMKUJRSFKJ-JLDROCMUSA-N |
| XLogP | 3.15 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|