About 4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-N-[2-(trifluoromethyl)phenyl]sulfanylpyridin-2-amine
4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-N-[2-(trifluoromethyl)phenyl]sulfanylpyridin-2-amine (PubChem CID 143408387) has the molecular formula C18H11F3N4OS
and a molecular weight of 388.37 g/mol. Its IUPAC name is 4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-N-[2-(trifluoromethyl)phenyl]sulfanylpyridin-2-amine.
Molecular Properties
| Compound Name | 4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-N-[2-(trifluoromethyl)phenyl]sulfanylpyridin-2-amine |
| PubChem CID | 143408387 |
| Molecular Formula | C18H11F3N4OS |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-N-[2-(trifluoromethyl)phenyl]sulfanylpyridin-2-amine |
| SMILES | FC(F)(F)c1ccccc1SNc1cc(-c2nc3ncccc3o2)ccn1 |
| InChI | InChI=1S/C18H11F3N4OS/c19-18(20,21)12-4-1-2-6-14(12)27-25-15-10-11(7-9-22-15)17-24-16-13(26-17)5-3-8-23-16/h1-10H,(H,22,25) |
| InChIKey | QTZUDSWIHDLCLE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-N-[2-(trifluoromethyl)phenyl]sulfanylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-N-[2-(trifluoromethyl)phenyl]sulfanylpyridin-2-amine?
The IUPAC name of 4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-N-[2-(trifluoromethyl)phenyl]sulfanylpyridin-2-amine (CID 143408387) is 4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-N-[2-(trifluoromethyl)phenyl]sulfanylpyridin-2-amine.
What is the SMILES notation for 4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-N-[2-(trifluoromethyl)phenyl]sulfanylpyridin-2-amine?
The canonical SMILES for 4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-N-[2-(trifluoromethyl)phenyl]sulfanylpyridin-2-amine is FC(F)(F)c1ccccc1SNc1cc(-c2nc3ncccc3o2)ccn1.
What is the InChIKey of 4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-N-[2-(trifluoromethyl)phenyl]sulfanylpyridin-2-amine?
The InChIKey is QTZUDSWIHDLCLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11F3N4OS/c19-18(20,21)12-4-1-2-6-14(12)27-25-15-10-11(7-9-22-15)17-24-16-13(26-17)5-3-8-23-16/h1-10H,(H,22,25).
What are the key properties of 4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-N-[2-(trifluoromethyl)phenyl]sulfanylpyridin-2-amine?
4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-N-[2-(trifluoromethyl)phenyl]sulfanylpyridin-2-amine has a molecular weight of 388.37 g/mol, XLogP of 5.42, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-([1,3]oxazolo[4,5-b]pyridin-2-yl)-N-[2-(trifluoromethyl)phenyl]sulfanylpyridin-2-amine is sourced from PubChem (CID 143408387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).