C23H23N3O5 — CID 143408388
N-[4-(1,2-dihydro-[1,3]oxazolo[5,4-c]pyridin-2-yl)phenyl]-3,5,6-trimethoxycyclohepta-1,4,6-triene-1-carboxamide (PubChem CID 143408388) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is N-[4-(1,2-dihydro-[1,3]oxazolo[5,4-c]pyridin-2-yl)phenyl]-3,5,6-trimethoxycyclohepta-1,4,6-triene-1-carboxamide.
| Compound Name | N-[4-(1,2-dihydro-[1,3]oxazolo[5,4-c]pyridin-2-yl)phenyl]-3,5,6-trimethoxycyclohepta-1,4,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 143408388 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-[4-(1,2-dihydro-[1,3]oxazolo[5,4-c]pyridin-2-yl)phenyl]-3,5,6-trimethoxycyclohepta-1,4,6-triene-1-carboxamide |
| SMILES | COC1=CC(C(=O)Nc2ccc(C3Nc4ccncc4O3)cc2)=CC(OC)C=C1OC |
| InChI | InChI=1S/C23H23N3O5/c1-28-17-10-15(11-19(29-2)20(12-17)30-3)22(27)25-16-6-4-14(5-7-16)23-26-18-8-9-24-13-21(18)31-23/h4-13,17,23,26H,1-3H3,(H,25,27) |
| InChIKey | BVDCHOJLZQUVBP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |