C26H30N4O4S — CID 143408417
N-[3-[(dimethylamino)methyl]-6-methyl-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)cyclohexa-2,4-dien-1-yl]-3,4,5-trimethoxybenzamide (PubChem CID 143408417) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is N-[3-[(dimethylamino)methyl]-6-methyl-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)cyclohexa-2,4-dien-1-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-[(dimethylamino)methyl]-6-methyl-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)cyclohexa-2,4-dien-1-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 143408417 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | N-[3-[(dimethylamino)methyl]-6-methyl-5-([1,3]thiazolo[5,4-c]pyridin-2-yl)cyclohexa-2,4-dien-1-yl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC2C=C(CN(C)C)C=C(c3nc4ccncc4s3)C2C)cc(OC)c1OC |
| InChI | InChI=1S/C26H30N4O4S/c1-15-18(26-29-19-7-8-27-13-23(19)35-26)9-16(14-30(2)3)10-20(15)28-25(31)17-11-21(32-4)24(34-6)22(12-17)33-5/h7-13,15,20H,14H2,1-6H3,(H,28,31) |
| InChIKey | OLXWDCNPSPDCNB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |