C15H15N5O2 — CID 143408505
3-amino-N-(2-aminoethyl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)benzamide (PubChem CID 143408505) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 3-amino-N-(2-aminoethyl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)benzamide.
| Compound Name | 3-amino-N-(2-aminoethyl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)benzamide |
|---|---|
| PubChem CID | 143408505 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 3-amino-N-(2-aminoethyl)-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)benzamide |
| SMILES | NCCNC(=O)c1cc(N)cc(-c2nc3ncccc3o2)c1 |
| InChI | InChI=1S/C15H15N5O2/c16-3-5-19-14(21)9-6-10(8-11(17)7-9)15-20-13-12(22-15)2-1-4-18-13/h1-2,4,6-8H,3,5,16-17H2,(H,19,21) |
| InChIKey | NFMHHAGEBDWVEB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 120.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|