About N-[3-([1,3]thiazolo[4,5-b]pyridin-2-yl)phenyl]formamide
N-[3-([1,3]thiazolo[4,5-b]pyridin-2-yl)phenyl]formamide (PubChem CID 143408522) has the molecular formula C13H9N3OS
and a molecular weight of 255.30 g/mol. Its IUPAC name is N-[3-([1,3]thiazolo[4,5-b]pyridin-2-yl)phenyl]formamide.
Molecular Properties
| Compound Name | N-[3-([1,3]thiazolo[4,5-b]pyridin-2-yl)phenyl]formamide |
| PubChem CID | 143408522 |
| Molecular Formula | C13H9N3OS |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | N-[3-([1,3]thiazolo[4,5-b]pyridin-2-yl)phenyl]formamide |
| SMILES | O=CNc1cccc(-c2nc3ncccc3s2)c1 |
| InChI | InChI=1S/C13H9N3OS/c17-8-15-10-4-1-3-9(7-10)13-16-12-11(18-13)5-2-6-14-12/h1-8H,(H,15,17) |
| InChIKey | SIAGWNHPIRNXLX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[3-([1,3]thiazolo[4,5-b]pyridin-2-yl)phenyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-([1,3]thiazolo[4,5-b]pyridin-2-yl)phenyl]formamide?
The IUPAC name of N-[3-([1,3]thiazolo[4,5-b]pyridin-2-yl)phenyl]formamide (CID 143408522) is N-[3-([1,3]thiazolo[4,5-b]pyridin-2-yl)phenyl]formamide.
What is the SMILES notation for N-[3-([1,3]thiazolo[4,5-b]pyridin-2-yl)phenyl]formamide?
The canonical SMILES for N-[3-([1,3]thiazolo[4,5-b]pyridin-2-yl)phenyl]formamide is O=CNc1cccc(-c2nc3ncccc3s2)c1.
What is the InChIKey of N-[3-([1,3]thiazolo[4,5-b]pyridin-2-yl)phenyl]formamide?
The InChIKey is SIAGWNHPIRNXLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3OS/c17-8-15-10-4-1-3-9(7-10)13-16-12-11(18-13)5-2-6-14-12/h1-8H,(H,15,17).
What are the key properties of N-[3-([1,3]thiazolo[4,5-b]pyridin-2-yl)phenyl]formamide?
N-[3-([1,3]thiazolo[4,5-b]pyridin-2-yl)phenyl]formamide has a molecular weight of 255.30 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-([1,3]thiazolo[4,5-b]pyridin-2-yl)phenyl]formamide is sourced from PubChem (CID 143408522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).