C26H29N5OS — CID 143408606
N-[2-[5-(propylaminomethyl)-5,6-dihydro-[1,3]thiazolo[5,4-b]pyridin-2-yl]cyclohexa-2,4-dien-1-yl]-4a,8a-dihydroquinoline-2-carboxamide (PubChem CID 143408606) has the molecular formula C26H29N5OS and a molecular weight of 459.62 g/mol. Its IUPAC name is N-[2-[5-(propylaminomethyl)-5,6-dihydro-[1,3]thiazolo[5,4-b]pyridin-2-yl]cyclohexa-2,4-dien-1-yl]-4a,8a-dihydroquinoline-2-carboxamide.
| Compound Name | N-[2-[5-(propylaminomethyl)-5,6-dihydro-[1,3]thiazolo[5,4-b]pyridin-2-yl]cyclohexa-2,4-dien-1-yl]-4a,8a-dihydroquinoline-2-carboxamide |
|---|---|
| PubChem CID | 143408606 |
| Molecular Formula | C26H29N5OS |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | N-[2-[5-(propylaminomethyl)-5,6-dihydro-[1,3]thiazolo[5,4-b]pyridin-2-yl]cyclohexa-2,4-dien-1-yl]-4a,8a-dihydroquinoline-2-carboxamide |
| SMILES | CCCNCC1CC=c2nc(C3=CC=CCC3NC(=O)C3=NC4C=CC=CC4C=C3)sc2=N1 |
| InChI | InChI=1S/C26H29N5OS/c1-2-15-27-16-18-12-14-23-26(28-18)33-25(31-23)19-8-4-6-10-21(19)30-24(32)22-13-11-17-7-3-5-9-20(17)29-22/h3-9,11,13-14,17-18,20-21,27H,2,10,12,15-16H2,1H3,(H,30,32) |
| InChIKey | GXFQHXWNVQXXGV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|