C21H19N7O2S — CID 143408806
N-[2-[3-[(2-aminoethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]-2,1,3-benzoxadiazole-5-carboxamide (PubChem CID 143408806) has the molecular formula C21H19N7O2S and a molecular weight of 433.50 g/mol. Its IUPAC name is N-[2-[3-[(2-aminoethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]-2,1,3-benzoxadiazole-5-carboxamide.
| Compound Name | N-[2-[3-[(2-aminoethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]-2,1,3-benzoxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 143408806 |
| Molecular Formula | C21H19N7O2S |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N-[2-[3-[(2-aminoethylamino)methyl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]-2,1,3-benzoxadiazole-5-carboxamide |
| SMILES | NCCNCc1csc2nc(-c3ccccc3NC(=O)c3ccc4nonc4c3)cn12 |
| InChI | InChI=1S/C21H19N7O2S/c22-7-8-23-10-14-12-31-21-25-19(11-28(14)21)15-3-1-2-4-16(15)24-20(29)13-5-6-17-18(9-13)27-30-26-17/h1-6,9,11-12,23H,7-8,10,22H2,(H,24,29) |
| InChIKey | PYXIPTQUUITCLU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|