C25H23N5O2S — CID 143409241
1-[4-[[2-(methylamino)-3-pyridinyl]oxymethyl]-2-pyridinyl]-3-(4-phenoxyphenyl)thiourea (PubChem CID 143409241) has the molecular formula C25H23N5O2S and a molecular weight of 457.56 g/mol. Its IUPAC name is 1-[4-[[2-(methylamino)-3-pyridinyl]oxymethyl]-2-pyridinyl]-3-(4-phenoxyphenyl)thiourea.
| Compound Name | 1-[4-[[2-(methylamino)-3-pyridinyl]oxymethyl]-2-pyridinyl]-3-(4-phenoxyphenyl)thiourea |
|---|---|
| PubChem CID | 143409241 |
| Molecular Formula | C25H23N5O2S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 1-[4-[[2-(methylamino)-3-pyridinyl]oxymethyl]-2-pyridinyl]-3-(4-phenoxyphenyl)thiourea |
| SMILES | CNc1ncccc1OCc1ccnc(NC(=S)Nc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H23N5O2S/c1-26-24-22(8-5-14-28-24)31-17-18-13-15-27-23(16-18)30-25(33)29-19-9-11-21(12-10-19)32-20-6-3-2-4-7-20/h2-16H,17H2,1H3,(H,26,28)(H2,27,29,30,33) |
| InChIKey | AOEFKUOKEIVJHU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|