About 2,5-dimethyl-4H-1,3-thiazine;ethane
2,5-dimethyl-4H-1,3-thiazine;ethane (PubChem CID 143409599) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is 2,5-dimethyl-4H-1,3-thiazine;ethane.
Molecular Properties
| Compound Name | 2,5-dimethyl-4H-1,3-thiazine;ethane |
| PubChem CID | 143409599 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2,5-dimethyl-4H-1,3-thiazine;ethane |
| SMILES | CC.CC1=CSC(C)=NC1 |
| InChI | InChI=1S/C6H9NS.C2H6/c1-5-3-7-6(2)8-4-5;1-2/h4H,3H2,1-2H3;1-2H3 |
| InChIKey | AWJLEVFTUAXXSV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dimethyl-4H-1,3-thiazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-4H-1,3-thiazine;ethane?
The IUPAC name of 2,5-dimethyl-4H-1,3-thiazine;ethane (CID 143409599) is 2,5-dimethyl-4H-1,3-thiazine;ethane.
What is the SMILES notation for 2,5-dimethyl-4H-1,3-thiazine;ethane?
The canonical SMILES for 2,5-dimethyl-4H-1,3-thiazine;ethane is CC.CC1=CSC(C)=NC1.
What is the InChIKey of 2,5-dimethyl-4H-1,3-thiazine;ethane?
The InChIKey is AWJLEVFTUAXXSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NS.C2H6/c1-5-3-7-6(2)8-4-5;1-2/h4H,3H2,1-2H3;1-2H3.
What are the key properties of 2,5-dimethyl-4H-1,3-thiazine;ethane?
2,5-dimethyl-4H-1,3-thiazine;ethane has a molecular weight of 157.28 g/mol, XLogP of 3.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-4H-1,3-thiazine;ethane is sourced from PubChem (CID 143409599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).