About 7,8-dihydropyrido[3,2-d]pyrimidin-4-amine;ethane
7,8-dihydropyrido[3,2-d]pyrimidin-4-amine;ethane (PubChem CID 143410514) has the molecular formula C11H20N4
and a molecular weight of 208.31 g/mol. Its IUPAC name is 7,8-dihydropyrido[3,2-d]pyrimidin-4-amine;ethane.
Molecular Properties
| Compound Name | 7,8-dihydropyrido[3,2-d]pyrimidin-4-amine;ethane |
| PubChem CID | 143410514 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 7,8-dihydropyrido[3,2-d]pyrimidin-4-amine;ethane |
| SMILES | CC.CC.Nc1ncnc2c1N=CCC2 |
| InChI | InChI=1S/C7H8N4.2C2H6/c8-7-6-5(10-4-11-7)2-1-3-9-6;2*1-2/h3-4H,1-2H2,(H2,8,10,11);2*1-2H3 |
| InChIKey | ZPFOARWTDJWSAY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7,8-dihydropyrido[3,2-d]pyrimidin-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydropyrido[3,2-d]pyrimidin-4-amine;ethane?
The IUPAC name of 7,8-dihydropyrido[3,2-d]pyrimidin-4-amine;ethane (CID 143410514) is 7,8-dihydropyrido[3,2-d]pyrimidin-4-amine;ethane.
What is the SMILES notation for 7,8-dihydropyrido[3,2-d]pyrimidin-4-amine;ethane?
The canonical SMILES for 7,8-dihydropyrido[3,2-d]pyrimidin-4-amine;ethane is CC.CC.Nc1ncnc2c1N=CCC2.
What is the InChIKey of 7,8-dihydropyrido[3,2-d]pyrimidin-4-amine;ethane?
The InChIKey is ZPFOARWTDJWSAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4.2C2H6/c8-7-6-5(10-4-11-7)2-1-3-9-6;2*1-2/h3-4H,1-2H2,(H2,8,10,11);2*1-2H3.
What are the key properties of 7,8-dihydropyrido[3,2-d]pyrimidin-4-amine;ethane?
7,8-dihydropyrido[3,2-d]pyrimidin-4-amine;ethane has a molecular weight of 208.31 g/mol, XLogP of 2.76, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydropyrido[3,2-d]pyrimidin-4-amine;ethane is sourced from PubChem (CID 143410514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).