About (3E)-3-(1-aminopropylidene)-1,1-dimethylurea
(3E)-3-(1-aminopropylidene)-1,1-dimethylurea (PubChem CID 143410518) has the molecular formula C6H13N3O
and a molecular weight of 143.19 g/mol. Its IUPAC name is (3E)-3-(1-aminopropylidene)-1,1-dimethylurea.
Molecular Properties
| Compound Name | (3E)-3-(1-aminopropylidene)-1,1-dimethylurea |
| PubChem CID | 143410518 |
| Molecular Formula | C6H13N3O |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | (3E)-3-(1-aminopropylidene)-1,1-dimethylurea |
| SMILES | CC/C(N)=N\C(=O)N(C)C |
| InChI | InChI=1S/C6H13N3O/c1-4-5(7)8-6(10)9(2)3/h4H2,1-3H3,(H2,7,8,10) |
| InChIKey | KHHWXZSKVGORII-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(1-aminopropylidene)-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(1-aminopropylidene)-1,1-dimethylurea?
The IUPAC name of (3E)-3-(1-aminopropylidene)-1,1-dimethylurea (CID 143410518) is (3E)-3-(1-aminopropylidene)-1,1-dimethylurea.
What is the SMILES notation for (3E)-3-(1-aminopropylidene)-1,1-dimethylurea?
The canonical SMILES for (3E)-3-(1-aminopropylidene)-1,1-dimethylurea is CC/C(N)=N\C(=O)N(C)C.
What is the InChIKey of (3E)-3-(1-aminopropylidene)-1,1-dimethylurea?
The InChIKey is KHHWXZSKVGORII-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O/c1-4-5(7)8-6(10)9(2)3/h4H2,1-3H3,(H2,7,8,10).
What are the key properties of (3E)-3-(1-aminopropylidene)-1,1-dimethylurea?
(3E)-3-(1-aminopropylidene)-1,1-dimethylurea has a molecular weight of 143.19 g/mol, XLogP of 0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(1-aminopropylidene)-1,1-dimethylurea is sourced from PubChem (CID 143410518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).