About ethyl (3Z)-3-[(3-ethyl-3,4-dihydropyridazin-6-yl)hydrazinylidene]butanoate
ethyl (3Z)-3-[(3-ethyl-3,4-dihydropyridazin-6-yl)hydrazinylidene]butanoate (PubChem CID 143410899) has the molecular formula C12H20N4O2
and a molecular weight of 252.32 g/mol. Its IUPAC name is ethyl (3Z)-3-[(3-ethyl-3,4-dihydropyridazin-6-yl)hydrazinylidene]butanoate.
Molecular Properties
| Compound Name | ethyl (3Z)-3-[(3-ethyl-3,4-dihydropyridazin-6-yl)hydrazinylidene]butanoate |
| PubChem CID | 143410899 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | ethyl (3Z)-3-[(3-ethyl-3,4-dihydropyridazin-6-yl)hydrazinylidene]butanoate |
| SMILES | CCOC(=O)C/C(C)=N\NC1=CCC(CC)N=N1 |
| InChI | InChI=1S/C12H20N4O2/c1-4-10-6-7-11(16-14-10)15-13-9(3)8-12(17)18-5-2/h7,10,15H,4-6,8H2,1-3H3/b13-9- |
| InChIKey | KZMGGTSKPCJDNJ-LCYFTJDESA-N |
| XLogP | 2.38 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3Z)-3-[(3-ethyl-3,4-dihydropyridazin-6-yl)hydrazinylidene]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3Z)-3-[(3-ethyl-3,4-dihydropyridazin-6-yl)hydrazinylidene]butanoate?
The IUPAC name of ethyl (3Z)-3-[(3-ethyl-3,4-dihydropyridazin-6-yl)hydrazinylidene]butanoate (CID 143410899) is ethyl (3Z)-3-[(3-ethyl-3,4-dihydropyridazin-6-yl)hydrazinylidene]butanoate.
What is the SMILES notation for ethyl (3Z)-3-[(3-ethyl-3,4-dihydropyridazin-6-yl)hydrazinylidene]butanoate?
The canonical SMILES for ethyl (3Z)-3-[(3-ethyl-3,4-dihydropyridazin-6-yl)hydrazinylidene]butanoate is CCOC(=O)C/C(C)=N\NC1=CCC(CC)N=N1.
What is the InChIKey of ethyl (3Z)-3-[(3-ethyl-3,4-dihydropyridazin-6-yl)hydrazinylidene]butanoate?
The InChIKey is KZMGGTSKPCJDNJ-LCYFTJDESA-N. The full InChI is InChI=1S/C12H20N4O2/c1-4-10-6-7-11(16-14-10)15-13-9(3)8-12(17)18-5-2/h7,10,15H,4-6,8H2,1-3H3/b13-9-.
What are the key properties of ethyl (3Z)-3-[(3-ethyl-3,4-dihydropyridazin-6-yl)hydrazinylidene]butanoate?
ethyl (3Z)-3-[(3-ethyl-3,4-dihydropyridazin-6-yl)hydrazinylidene]butanoate has a molecular weight of 252.32 g/mol, XLogP of 2.38, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3Z)-3-[(3-ethyl-3,4-dihydropyridazin-6-yl)hydrazinylidene]butanoate is sourced from PubChem (CID 143410899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).